5-MAPDB
1-(2,3-Dihydro-1-benzofuran-5-yl)-N-methylpropan-2-amine
 1429 C12H17NO 191.269
 InChI=1S/C12H17NO/c1-9(13-2)7-10-3-4-12-11(8-10)5-6-14-12/h3-4,8-9,13H,5-7H2,1-2H3
 PLQTZOCLUHHCOI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1ccc2c(c1)CCO2)C