O-2418
1-(4-Hydroxyphenyl)-2-(pyrrolidin-1-yl)pentan-1-one
 1415 C15H21NO2 247.333
 InChI=1S/C15H21NO2/c1-2-5-14(16-10-3-4-11-16)15(18)12-6-8-13(17)9-7-12/h6-9,14,17H,2-5,10-11H2,1H3
 XCHIECWEKDGHNL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCC(C(=O)c1ccc(cc1)O)N1CCCC1