AMP-4en-PINACA
N-[(2S)-1-Amino-1-oxobutan-2-yl]-1-(pent-4-en-1-yl)-1H-indazole-3-carboxamide
 13847  C17H22N4O2  314.382
 Cannabinoid
 InChI=1S/C17H22N4O2/c1-3-5-8-11-21-14-10-7-6-9-12(14)15(20-21)17(23)19-13(4-2)16(18)22/h3,6-7,9-10,13H,1,4-5,8,11H2,2H3,(H2,18,22)(H,19,23)/t13-/m0/s1
 SHELRBQJCJWWQC-ZDUSSCGKSA-N This stereoisomer Any stereoisomer
 C=CCCCn1nc(c2c1cccc2)C(=O)N[C@H](C(=O)N)CC