2-(2,6-Dimethoxy-4-methylphenyl)cyclopropan-1-amine
 13734  C12H17NO2  207.269
 InChI=1S/C12H17NO2/c1-7-4-10(14-2)12(8-6-9(8)13)11(5-7)15-3/h4-5,8-9H,6,13H2,1-3H3
 QZIFMDNBAVXLGF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C)cc(c1C1CC1N)OC