Tehuanine-N-oxide
5,6,7-Trimethoxy-2-methyl-2-oxo-1,2,3,4-tetrahydro-2λ5-isoquinoline
 13733  C13H19NO4  253.294
 InChI=1S/C13H19NO4/c1-14(15)6-5-10-9(8-14)7-11(16-2)13(18-4)12(10)17-3/h7H,5-6,8H2,1-4H3
 OHDVYNIZAWGLGE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc2CN(=O)(C)CCc2c(c1OC)OC