4-{1-Hydroxy-2-[(3-hydroxypropyl)amino]ethyl}benzene-1,2-diol
 1350 C11H17NO4 227.257
 InChI=1S/C11H17NO4/c13-5-1-4-12-7-11(16)8-2-3-9(14)10(15)6-8/h2-3,6,11-16H,1,4-5,7H2
 GNCYSXKWDZSSND-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 OCCCNCC(c1ccc(c(c1)O)O)O