RU-24213
N,N-Bis(2-phenylethyl)propan-1-amine
 1344  C19H25N  267.409
 InChI=1S/C19H25N/c1-2-15-20(16-13-18-9-5-3-6-10-18)17-14-19-11-7-4-8-12-19/h3-12H,2,13-17H2,1H3
 RPEJSKBNTPQAFK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(CCc1ccccc1)CCc1ccccc1