N-Isopropyl-N-methyl-2-aminotetralin
N-Methyl-N-(propan-2-yl)-1,2,3,4-tetrahydronaphthalen-2-amine
 1326 C14H21N 203.323
 InChI=1S/C14H21N/c1-11(2)15(3)14-9-8-12-6-4-5-7-13(12)10-14/h4-7,11,14H,8-10H2,1-3H3
 IVDMGOWPNCJYBO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C1CCc2c(C1)cccc2)C(C)C