N,N-DIpropyl-2-aminotetralin
N,N-Dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine
 1324 C16H25N 231.376
 InChI=1S/C16H25N/c1-3-11-17(12-4-2)16-10-9-14-7-5-6-8-15(14)13-16/h5-8,16H,3-4,9-13H2,1-2H3
 IMMAROBNUIRASX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(C1CCc2c(C1)cccc2)CCC