N,N-Diethyl-2-aminotetralin
N,N-Diethyl-1,2,3,4-tetrahydronaphthalen-2-amine
 1323 C14H21N 203.323
 InChI=1S/C14H21N/c1-3-15(4-2)14-10-9-12-7-5-6-8-13(12)11-14/h5-8,14H,3-4,9-11H2,1-2H3
 HKKFAEDOOMPSFN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(C1CCc2c(C1)cccc2)CC