N-Butyl-2-aminotetralin
N-Butyl-1,2,3,4-tetrahydronaphthalen-2-amine
 1321 C14H21N 203.323
 InChI=1S/C14H21N/c1-2-3-10-15-14-9-8-12-6-4-5-7-13(12)11-14/h4-7,14-15H,2-3,8-11H2,1H3
 FSXXDNPGFQZQSR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCNC1CCc2c(C1)cccc2