N-(Propan-2-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-amine
 1308 C14H21N 203.323
 InChI=1S/C14H21N/c1-11(2)15-14-9-5-8-12-6-3-4-7-13(12)10-14/h3-4,6-7,11,14-15H,5,8-10H2,1-2H3
 XJQDBYSBWJWTFU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(NC1CCCc2c(C1)cccc2)C