1-(4-Methoxyphenoxy)propan-2-amine
 12414 C10H15NO2 181.232
 InChI=1S/C10H15NO2/c1-8(11)7-13-10-5-3-9(12-2)4-6-10/h3-6,8H,7,11H2,1-2H3
 FCFNBPVBEYMDKC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1)OCC(N)C