4-Ethoxy-3-ethylthio-5-methoxy-β-nitrostyrene
2-Ethoxy-1-(ethylsulfanyl)-3-methoxy-5-[(E)-2-nitroethenyl]benzene
 12404  C13H17NO4S  283.343
 InChI=1S/C13H17NO4S/c1-4-18-13-11(17-3)8-10(6-7-14(15)16)9-12(13)19-5-2/h6-9H,4-5H2,1-3H3/b7-6+
 APZWVMXIBLWUEC-VOTSOKGWSA-N This stereoisomer Any stereoisomer
 CCOc1c(SCC)cc(cc1OC)/C=C/N(=O)=O