4-Bromo-2,5-dimethoxy-β-nitrostyrene
1-Bromo-2,5-dimethoxy-4-[(E)-2-nitroethenyl]benzene
 12403  C10H10BrNO4  288.095
 InChI=1S/C10H10BrNO4/c1-15-9-6-8(11)10(16-2)5-7(9)3-4-12(13)14/h3-6H,1-2H3/b4-3+
 SYFSECIFVKQCOD-ONEGZZNKSA-N This stereoisomer Any stereoisomer
 COc1cc(Br)c(cc1/C=C/N(=O)=O)OC