3-Ethoxy-4-methoxy-5-methylthio-β-nitrostyrene
1-Ethoxy-2-methoxy-3-(methylsulfanyl)-5-[(E)-2-nitroethenyl]benzene
 12396  C12H15NO4S  269.317
 InChI=1S/C12H15NO4S/c1-4-17-10-7-9(5-6-13(14)15)8-11(18-3)12(10)16-2/h5-8H,4H2,1-3H3/b6-5+
 AKPKUSBVLOFMQS-AATRIKPKSA-N This stereoisomer Any stereoisomer
 CCOc1cc(/C=C/N(=O)=O)cc(c1OC)SC