10.1016j.bmcl.2011.02.082 #14a
1-[(4,4-Difluoropiperidin-1-yl)methyl]-N-{[1-(hydroxymethyl)cyclopentyl]methyl}imidazo[1,5-a]pyridine-3-carboxamide
 12394  C21H28F2N4O2  406.469
 Cannabinoid
 InChI=1S/C21H28F2N4O2/c22-21(23)8-11-26(12-9-21)13-16-17-5-1-4-10-27(17)18(25-16)19(29)24-14-20(15-28)6-2-3-7-20/h1,4-5,10,28H,2-3,6-9,11-15H2,(H,24,29)
 KSBLATLJUVACEJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 OCC1(CCCC1)CNC(=O)c1nc(c2n1cccc2)CN1CCC(CC1)(F)F