2,5-Dimethoxy-β-nitrostyrene
1,4-Dimethoxy-2-[(E)-2-nitroethenyl]benzene
 12389  C10H11NO4  209.199
 InChI=1S/C10H11NO4/c1-14-9-3-4-10(15-2)8(7-9)5-6-11(12)13/h3-7H,1-2H3/b6-5+
 IRRZIWHEPWPPJF-AATRIKPKSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1/C=C/N(=O)=O)OC