2,5-Dimethoxy-4-fluoro-β-nitrostyrene
1-Fluoro-2,5-dimethoxy-4-[(E)-2-nitroethenyl]benzene
 12385  C10H10FNO4  227.189
 InChI=1S/C10H10FNO4/c1-15-9-6-8(11)10(16-2)5-7(9)3-4-12(13)14/h3-6H,1-2H3/b4-3+
 KFFINUCZICVIRL-ONEGZZNKSA-N This stereoisomer Any stereoisomer
 COc1cc(F)c(cc1/C=C/N(=O)=O)OC