2,5-Dimethoxy-4-ethyl-β-nitrostyrene
1-Ethyl-2,5-dimethoxy-4-[(E)-2-nitroethenyl]benzene
 12383  C12H15NO4  237.252
 InChI=1S/C12H15NO4/c1-4-9-7-12(17-3)10(5-6-13(14)15)8-11(9)16-2/h5-8H,4H2,1-3H3/b6-5+
 QHCLACIRZLUQEU-AATRIKPKSA-N This stereoisomer Any stereoisomer
 COc1cc(CC)c(cc1/C=C/N(=O)=O)OC