2,4,6-Trimethoxy-β-methyl-β-nitrostyrene
1,3,5-Trimethoxy-2-[(1E)-2-nitroprop-1-en-1-yl]benzene
 12369  C12H15NO5  253.251
 InChI=1S/C12H15NO5/c1-8(13(14)15)5-10-11(17-3)6-9(16-2)7-12(10)18-4/h5-7H,1-4H3/b8-5+
 JAPSFFLFSUERST-VMPITWQZSA-N This stereoisomer Any stereoisomer
 COc1cc(OC)cc(c1/C=C(/N(=O)=O)\C)OC