2,3,6-Trimethoxy-β-methyl-β-nitrostyrene
1,2,4-Trimethoxy-3-[(1E)-2-nitroprop-1-en-1-yl]benzene
 12365  C12H15NO5  253.251
 InChI=1S/C12H15NO5/c1-8(13(14)15)7-9-10(16-2)5-6-11(17-3)12(9)18-4/h5-7H,1-4H3/b8-7+
 NQNDJYSFXPIGSC-BQYQJAHWSA-N This stereoisomer Any stereoisomer
 COc1ccc(c(c1/C=C(/N(=O)=O)\C)OC)OC