4-Propoxy-β-methyl-β-nitrostyrene
1-[(1E)-2-Nitroprop-1-en-1-yl]-4-propoxybenzene
 12348  C12H15NO3  221.252
 InChI=1S/C12H15NO3/c1-3-8-16-12-6-4-11(5-7-12)9-10(2)13(14)15/h4-7,9H,3,8H2,1-2H3/b10-9+
 DBTQSBIRNNZQER-MDZDMXLPSA-N This stereoisomer Any stereoisomer
 CCCOc1ccc(cc1)/C=C(/N(=O)=O)\C