3-Ethoxy-β-methyl-β-nitrostyrene
1-Ethoxy-3-[(1E)-2-nitroprop-1-en-1-yl]benzene
 12345  C11H13NO3  207.226
 InChI=1S/C11H13NO3/c1-3-15-11-6-4-5-10(8-11)7-9(2)12(13)14/h4-8H,3H2,1-2H3/b9-7+
 NGYPKBMHHLUPAR-VQHVLOKHSA-N This stereoisomer Any stereoisomer
 CCOc1cccc(c1)/C=C(/N(=O)=O)\C