2-Methoxy-β-methyl-β-nitrostyrene
1-Methoxy-2-[(1E)-2-nitroprop-1-en-1-yl]benzene
 12342  C10H11NO3  193.199
 InChI=1S/C10H11NO3/c1-8(11(12)13)7-9-5-3-4-6-10(9)14-2/h3-7H,1-2H3/b8-7+
 OFYVONMDKJKATB-BQYQJAHWSA-N This stereoisomer Any stereoisomer
 COc1ccccc1/C=C(/N(=O)=O)\C