3,5-DMBAL
3,5-Dimethoxybenzaldehyde
 12322 C9H10O3 166.174
 InChI=1S/C9H10O3/c1-11-8-3-7(6-10)4-9(5-8)12-2/h3-6H,1-2H3
 VFZRZRDOXPRTSC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(OC)cc(c1)C=O