3-EtO-4-MBAL
3-Ethoxy-4-methoxybenzaldehyde
 12318 C10H12O3 180.2
 InChI=1S/C10H12O3/c1-3-13-10-6-8(7-11)4-5-9(10)12-2/h4-7H,3H2,1-2H3
 VAMZHXWLGRQSJS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cc(C=O)ccc1OC