4-Hydroxy-2,6-dimethoxybenzaldehyde
 12246  C9H10O4  182.173
 InChI=1S/C9H10O4/c1-12-8-3-6(11)4-9(13-2)7(8)5-10/h3-5,11H,1-2H3
 HZWPJAZIRZFCGX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(O)cc(c1C=O)OC