2-[4-Amino-3-chloro-5-(trifluoromethyl)phenyl]-2-(tert-butylamino)ethan-1-ol
 12221 C13H18ClF3N2O 310.743
 InChI=1S/C13H18ClF3N2O/c1-12(2,3)19-10(6-20)7-4-8(13(15,16)17)11(18)9(14)5-7/h4-5,10,19-20H,6,18H2,1-3H3
 SWCKXUXUVUSMDI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 OCC(c1cc(Cl)c(c(c1)C(F)(F)F)N)NC(C)(C)C