3-Fluoro-4,5-methylenedioxy-β-methyl-β-nitrostyrene
4-Fluoro-6-[(1E)-2-nitroprop-1-en-1-yl]-2H-1,3-benzodioxole
 12220 C10H8FNO4 225.173
 InChI=1S/C10H8FNO4/c1-6(12(13)14)2-7-3-8(11)10-9(4-7)15-5-16-10/h2-4H,5H2,1H3/b6-2+
 VRDLYMVUEMCSOU-QHHAFSJGSA-N This stereoisomer Any stereoisomer
 C/C(=C\c1cc(F)c2c(c1)OCO2)/N(=O)=O