3-F-3,4-MDBAL
7-Fluoro-2H-1,3-benzodioxole-5-carbaldehyde
 12219 C8H5FO3 168.122
 InChI=1S/C8H5FO3/c9-6-1-5(3-10)2-7-8(6)12-4-11-7/h1-3H,4H2
 NDIFBXNJTOFFAX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=Cc1cc(F)c2c(c1)OCO2