3-F-4,5-DHBAL
3-Fluoro-4,5-dihydroxybenzaldehyde
 12218 C7H5FO3 156.111
 InChI=1S/C7H5FO3/c8-5-1-4(3-9)2-6(10)7(5)11/h1-3,10-11H
 AFSUIFYFQDSKPC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=Cc1cc(O)c(c(c1)F)O