3-F-4-HO-5-MBAL
3-Fluoro-4-hydroxy-5-methoxybenzaldehyde
 12217 C8H7FO3 170.138
 InChI=1S/C8H7FO3/c1-12-7-3-5(4-10)2-6(9)8(7)11/h2-4,11H,1H3
 OOGOFUKAJDPHDJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C=O)cc(c1O)F