3-HO-4,5-DMBAL
3-Hydroxy-4,5-dimethoxybenzaldehyde
 12214 C9H10O4 182.173
 InChI=1S/C9H10O4/c1-12-8-4-6(5-10)3-7(11)9(8)13-2/h3-5,11H,1-2H3
 NVLTWXMZECWWPC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C=O)cc(c1OC)O