3,5-Dimethoxy-4-vinyloxy-β-nitrostyrene
2-(Ethenyloxy)-1,3-dimethoxy-5-[(E)-2-nitroethenyl]benzene
 12213 C12H13NO5 251.235
 InChI=1S/C12H13NO5/c1-4-18-12-10(16-2)7-9(5-6-13(14)15)8-11(12)17-3/h4-8H,1H2,2-3H3/b6-5+
 AOBGZLFIAXDLBN-AATRIKPKSA-N This stereoisomer Any stereoisomer
 C=COc1c(OC)cc(cc1OC)/C=C/N(=O)=O