4-VO-3,5-DMBAL
4-(Ethenyloxy)-3,5-dimethoxybenzaldehyde
 12212 C11H12O4 208.211
 InChI=1S/C11H12O4/c1-4-15-11-9(13-2)5-8(7-12)6-10(11)14-3/h4-7H,1H2,2-3H3
 HCKCYQDHRAWKRO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C=COc1c(OC)cc(cc1OC)C=O