1,3-Dimethoxy-5-[(E)-2-nitroethenyl]-2-(trifluoromethoxy)benzene
 12211 C11H10F3NO5 293.196
 InChI=1S/C11H10F3NO5/c1-18-8-5-7(3-4-15(16)17)6-9(19-2)10(8)20-11(12,13)14/h3-6H,1-2H3/b4-3+
 CRUPSWSKFQHQGQ-ONEGZZNKSA-N This stereoisomer Any stereoisomer
 COc1cc(/C=C/N(=O)=O)cc(c1OC(F)(F)F)OC