4-TFM-3,5-DMBAL
3,5-Dimethoxy-4-(trifluoromethoxy)benzaldehyde
 12210  C10H9F3O4  250.171
 InChI=1S/C10H9F3O4/c1-15-7-3-6(5-14)4-8(16-2)9(7)17-10(11,12)13/h3-5H,1-2H3
 KLCKFTMWOVGSAP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C=O)cc(c1OC(F)(F)F)OC