2-(Difluoromethoxy)-1,3-dimethoxy-5-[(E)-2-nitroethenyl]benzene
 12209 C11H11F2NO5 275.206
 InChI=1S/C11H11F2NO5/c1-17-8-5-7(3-4-14(15)16)6-9(18-2)10(8)19-11(12)13/h3-6,11H,1-2H3/b4-3+
 XCZCUJKQLGUOAH-ONEGZZNKSA-N This stereoisomer Any stereoisomer
 COc1cc(/C=C/N(=O)=O)cc(c1OC(F)F)OC