(3,4,5-Trimethoxyphenyl)acetonitrile
 12206 C11H13NO3 207.226
 InChI=1S/C11H13NO3/c1-13-9-6-8(4-5-12)7-10(14-2)11(9)15-3/h6-7H,4H2,1-3H3
 ACFJNTXCEQCDBX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 N#CCc1cc(OC)c(c(c1)OC)OC