Eudesmic acid
3,4,5-Trimethoxybenzoic acid
 12204 C10H12O5 212.199
 InChI=1S/C10H12O5/c1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3/h4-5H,1-3H3,(H,11,12)
 SJSOFNCYXJUNBT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(cc(c1OC)OC)C(=O)O