Adrenochrome
3-Hydroxy-1-methyl-2,3-dihydro-1H-indole-5,6-dione
 12203 C9H9NO3 179.173
 InChI=1S/C9H9NO3/c1-10-4-9(13)5-2-7(11)8(12)3-6(5)10/h2-3,9,13H,4H2,1H3
 RPHLQSHHTJORHI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 OC1CN(C2=CC(=O)C(=O)C=C12)C