Mescaline acetaldehyde
(3,4,5-Trimethoxyphenyl)acetaldehyde
 12202 C11H14O4 210.226
 InChI=1S/C11H14O4/c1-13-9-6-8(4-5-12)7-10(14-2)11(9)15-3/h5-7H,4H2,1-3H3
 PDZYOCOHQGFKLC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=CCc1cc(OC)c(c(c1)OC)OC