1-(1-Benzothiophen-3-yl)propan-2-amine
 12195  C11H13NS  191.293
 InChI=1S/C11H13NS/c1-8(12)6-9-7-13-11-5-3-2-4-10(9)11/h2-5,7-8H,6,12H2,1H3
 NJJBOBSLFFUELD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1csc2c1cccc2)N