1-(Cyclohepta-2,4,6-trien-1-yl)-N-methylpropan-2-amine
 12178 C11H17N 163.259
 InChI=1S/C11H17N/c1-10(12-2)9-11-7-5-3-4-6-8-11/h3-8,10-12H,9H2,1-2H3
 MUNSDPQNJCMUOX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(CC1C=CC=CC=C1)C