1-Cycloheptylpropan-2-amine
 12174 C10H21N 155.28
 InChI=1S/C10H21N/c1-9(11)8-10-6-4-2-3-5-7-10/h9-10H,2-8,11H2,1H3
 HIKHEESOCBLWLV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(CC1CCCCCC1)N