1-Cyclopentyl-N-ethylpropan-2-amine
 12162 C10H21N 155.28
 InChI=1S/C10H21N/c1-3-11-9(2)8-10-6-4-5-7-10/h9-11H,3-8H2,1-2H3
 GIVOLUCGAFEIGI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(CC1CCCC1)C