1-Cyclopentyl-N,N-dimethylpropan-2-amine
 12161 C10H21N 155.28
 InChI=1S/C10H21N/c1-9(11(2)3)8-10-6-4-5-7-10/h9-10H,4-8H2,1-3H3
 PJLFRZPIDRAZLE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(N(C)C)CC1CCCC1