3,4-Dihydro-2H-spiro[naphthalene-1,3′-pyrrolidine]
 12094 C13H17N 187.281
 InChI=1S/C13H17N/c1-2-6-12-11(4-1)5-3-7-13(12)8-9-14-10-13/h1-2,4,6,14H,3,5,7-10H2
 QAQOIXBLPQERTB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C1NCC2(C1)CCCc1c2cccc1