Chlorpromazine
3-(2-Chloro-10H-phenothiazin-10-yl)-N,N-dimethylpropan-1-amine
 12067 C17H19ClN2S 318.864
 InChI=1S/C17H19ClN2S/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20/h3-4,6-9,12H,5,10-11H2,1-2H3
 ZPEIMTDSQAKGNT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCCN1c2ccccc2Sc2c1cc(Cl)cc2)C